C18H30S — CID 91121113
3,7,8-trimethyl-4-(2-methylbut-1-enylsulfanyl)deca-2,4,6-triene (PubChem CID 91121113) has the molecular formula C18H30S and a molecular weight of 278.51 g/mol. Its IUPAC name is 3,7,8-trimethyl-4-(2-methylbut-1-enylsulfanyl)deca-2,4,6-triene.
| Compound Name | 3,7,8-trimethyl-4-(2-methylbut-1-enylsulfanyl)deca-2,4,6-triene |
|---|---|
| PubChem CID | 91121113 |
| Molecular Formula | C18H30S |
| Molecular Weight | 278.51 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | 3,7,8-trimethyl-4-(2-methylbut-1-enylsulfanyl)deca-2,4,6-triene |
| SMILES | CC=C(C)C(=CC=C(C)C(C)CC)SC=C(C)CC |
| InChI | InChI=1S/C18H30S/c1-8-14(4)13-19-18(16(6)10-3)12-11-17(7)15(5)9-2/h10-13,15H,8-9H2,1-7H3 |
| InChIKey | QRHDKBKQBUILNT-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.51 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|