C16H26S — CID 5362634
(1Z,5E)-1,5-dimethyl-9-methylsulfanyl-8-prop-1-en-2-ylcyclodeca-1,5-diene (PubChem CID 5362634) has the molecular formula C16H26S and a molecular weight of 250.45 g/mol. Its IUPAC name is (1Z,5E)-1,5-dimethyl-9-methylsulfanyl-8-prop-1-en-2-ylcyclodeca-1,5-diene.
| Compound Name | (1Z,5E)-1,5-dimethyl-9-methylsulfanyl-8-prop-1-en-2-ylcyclodeca-1,5-diene |
|---|---|
| PubChem CID | 5362634 |
| Molecular Formula | C16H26S |
| Molecular Weight | 250.45 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | (1Z,5E)-1,5-dimethyl-9-methylsulfanyl-8-prop-1-en-2-ylcyclodeca-1,5-diene |
| SMILES | C=C(C)C1C/C=C(\C)CC/C=C(/C)CC1SC |
| InChI | InChI=1S/C16H26S/c1-12(2)15-10-9-13(3)7-6-8-14(4)11-16(15)17-5/h8-9,15-16H,1,6-7,10-11H2,2-5H3/b13-9+,14-8- |
| InChIKey | GIMSCPKCRGSZQK-IXGQGZMGSA-N |
| XLogP | 5.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.45 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|