C16H27FS — CID 170732264
(2Z,4E,6E)-3-ethyl-5-(2-fluoropropan-2-yl)-6-methyl-8-methylsulfanylnona-2,4,6-triene (PubChem CID 170732264) has the molecular formula C16H27FS and a molecular weight of 270.46 g/mol. Its IUPAC name is (2Z,4E,6E)-3-ethyl-5-(2-fluoropropan-2-yl)-6-methyl-8-methylsulfanylnona-2,4,6-triene.
| Compound Name | (2Z,4E,6E)-3-ethyl-5-(2-fluoropropan-2-yl)-6-methyl-8-methylsulfanylnona-2,4,6-triene |
|---|---|
| PubChem CID | 170732264 |
| Molecular Formula | C16H27FS |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | (2Z,4E,6E)-3-ethyl-5-(2-fluoropropan-2-yl)-6-methyl-8-methylsulfanylnona-2,4,6-triene |
| SMILES | C/C=C(\C=C(C(/C)=C/C(C)SC)\C(C)(C)F)CC |
| InChI | InChI=1S/C16H27FS/c1-8-14(9-2)11-15(16(5,6)17)12(3)10-13(4)18-7/h8,10-11,13H,9H2,1-7H3/b12-10+,14-8-,15-11+ |
| InChIKey | GRMCMHNRAUWRIA-MUUKSQMNSA-N |
| XLogP | 5.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|