C20H38S — CID 14610171
8-(3,7-dimethyloct-6-enylsulfanyl)-2,6-dimethyloct-2-ene (PubChem CID 14610171) has the molecular formula C20H38S and a molecular weight of 310.59 g/mol. Its IUPAC name is 8-(3,7-dimethyloct-6-enylsulfanyl)-2,6-dimethyloct-2-ene.
| Compound Name | 8-(3,7-dimethyloct-6-enylsulfanyl)-2,6-dimethyloct-2-ene |
|---|---|
| PubChem CID | 14610171 |
| Molecular Formula | C20H38S |
| Molecular Weight | 310.59 g/mol |
| Exact Mass | 310.27 |
| IUPAC Name | 8-(3,7-dimethyloct-6-enylsulfanyl)-2,6-dimethyloct-2-ene |
| SMILES | CC(C)=CCCC(C)CCSCCC(C)CCC=C(C)C |
| InChI | InChI=1S/C20H38S/c1-17(2)9-7-11-19(5)13-15-21-16-14-20(6)12-8-10-18(3)4/h9-10,19-20H,7-8,11-16H2,1-6H3 |
| InChIKey | IIRIUHPEQJYGQV-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.59 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|