C17H22S — CID 91401368
3-(2-methylbut-2-enyl)-2-(2-methylprop-1-enyl)-5,6-dihydro-1-benzothiophene (PubChem CID 91401368) has the molecular formula C17H22S and a molecular weight of 258.43 g/mol. Its IUPAC name is 3-(2-methylbut-2-enyl)-2-(2-methylprop-1-enyl)-5,6-dihydro-1-benzothiophene.
| Compound Name | 3-(2-methylbut-2-enyl)-2-(2-methylprop-1-enyl)-5,6-dihydro-1-benzothiophene |
|---|---|
| PubChem CID | 91401368 |
| Molecular Formula | C17H22S |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 3-(2-methylbut-2-enyl)-2-(2-methylprop-1-enyl)-5,6-dihydro-1-benzothiophene |
| SMILES | CC=C(C)Cc1c(C=C(C)C)sc2c1=CCCC=2 |
| InChI | InChI=1S/C17H22S/c1-5-13(4)11-15-14-8-6-7-9-16(14)18-17(15)10-12(2)3/h5,8-10H,6-7,11H2,1-4H3 |
| InChIKey | VEBOFBYCIYKKFZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|