C21H24F3N2O2PS — CID 143144781
2-[3-methyl-5-[(3R)-3-methyl-4-[3-phosphanyl-4-(trifluoromethyl)phenyl]piperazin-1-yl]sulfanylphenyl]acetic acid (PubChem CID 143144781) has the molecular formula C21H24F3N2O2PS and a molecular weight of 456.47 g/mol. Its IUPAC name is 2-[3-methyl-5-[(3R)-3-methyl-4-[3-phosphanyl-4-(trifluoromethyl)phenyl]piperazin-1-yl]sulfanylphenyl]acetic acid.
| Compound Name | 2-[3-methyl-5-[(3R)-3-methyl-4-[3-phosphanyl-4-(trifluoromethyl)phenyl]piperazin-1-yl]sulfanylphenyl]acetic acid |
|---|---|
| PubChem CID | 143144781 |
| Molecular Formula | C21H24F3N2O2PS |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 2-[3-methyl-5-[(3R)-3-methyl-4-[3-phosphanyl-4-(trifluoromethyl)phenyl]piperazin-1-yl]sulfanylphenyl]acetic acid |
| SMILES | Cc1cc(CC(=O)O)cc(SN2CCN(c3ccc(C(F)(F)F)c(P)c3)[C@H](C)C2)c1 |
| InChI | InChI=1S/C21H24F3N2O2PS/c1-13-7-15(10-20(27)28)9-17(8-13)30-25-5-6-26(14(2)12-25)16-3-4-18(19(29)11-16)21(22,23)24/h3-4,7-9,11,14H,5-6,10,12,29H2,1-2H3,(H,27,28)/t14-/m1/s1 |
| InChIKey | VFBRDJICDSLKKF-CQSZACIVSA-N |
| XLogP | 4.36 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|