C7H10O4 — CID 14314802
2,2-dimethyl-1,3-dioxolane-4,5-dicarbaldehyde (PubChem CID 14314802) has the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. Its IUPAC name is 2,2-dimethyl-1,3-dioxolane-4,5-dicarbaldehyde.
| Compound Name | 2,2-dimethyl-1,3-dioxolane-4,5-dicarbaldehyde |
|---|---|
| PubChem CID | 14314802 |
| Molecular Formula | C7H10O4 |
| Molecular Weight | 158.15 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | 2,2-dimethyl-1,3-dioxolane-4,5-dicarbaldehyde |
| SMILES | CC1(C)OC(C=O)C(C=O)O1 |
| InChI | InChI=1S/C7H10O4/c1-7(2)10-5(3-8)6(4-9)11-7/h3-6H,1-2H3 |
| InChIKey | HZJHBGXHOJVFGH-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.15 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|