C19H33NO4 — CID 143148889
(1S)-1-[(1S,2S,4aS,6S)-2-hydroxy-1,6-dimethyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-1-hydroxy-2-(hydroxymethyl)-4-(methylamino)pentan-3-one (PubChem CID 143148889) has the molecular formula C19H33NO4 and a molecular weight of 339.48 g/mol. Its IUPAC name is (1S)-1-[(1S,2S,4aS,6S)-2-hydroxy-1,6-dimethyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-1-hydroxy-2-(hydroxymethyl)-4-(methylamino)pentan-3-one.
| Compound Name | (1S)-1-[(1S,2S,4aS,6S)-2-hydroxy-1,6-dimethyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-1-hydroxy-2-(hydroxymethyl)-4-(methylamino)pentan-3-one |
|---|---|
| PubChem CID | 143148889 |
| Molecular Formula | C19H33NO4 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | (1S)-1-[(1S,2S,4aS,6S)-2-hydroxy-1,6-dimethyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-1-hydroxy-2-(hydroxymethyl)-4-(methylamino)pentan-3-one |
| SMILES | CNC(C)C(=O)C(CO)[C@H](O)[C@@]1(C)C2CC[C@H](C)C[C@H]2C=C[C@@H]1O |
| InChI | InChI=1S/C19H33NO4/c1-11-5-7-15-13(9-11)6-8-16(22)19(15,3)18(24)14(10-21)17(23)12(2)20-4/h6,8,11-16,18,20-22,24H,5,7,9-10H2,1-4H3/t11-,12?,13+,14?,15?,16-,18-,19-/m0/s1 |
| InChIKey | RJTBPDOGNJZDGM-GLAMNMKDSA-N |
| XLogP | 1.12 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|