C8H16N2 — CID 143149332
ethane;(1E)-3-methyl-1-(methylideneamino)buta-1,3-dien-2-amine (PubChem CID 143149332) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is ethane;(1E)-3-methyl-1-(methylideneamino)buta-1,3-dien-2-amine.
| Compound Name | ethane;(1E)-3-methyl-1-(methylideneamino)buta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 143149332 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | ethane;(1E)-3-methyl-1-(methylideneamino)buta-1,3-dien-2-amine |
| SMILES | C=N/C=C(/N)C(=C)C.CC |
| InChI | InChI=1S/C6H10N2.C2H6/c1-5(2)6(7)4-8-3;1-2/h4H,1,3,7H2,2H3;1-2H3/b6-4+; |
| InChIKey | SVTBYKLJDJDPII-CVDVRWGVSA-N |
| XLogP | 2.09 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|