C10H18N2 — CID 144852900
ethane;N-[(1Z,3E)-3-methyl-2-(methylideneamino)penta-1,3-dienyl]methanimine (PubChem CID 144852900) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is ethane;N-[(1Z,3E)-3-methyl-2-(methylideneamino)penta-1,3-dienyl]methanimine.
| Compound Name | ethane;N-[(1Z,3E)-3-methyl-2-(methylideneamino)penta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 144852900 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | ethane;N-[(1Z,3E)-3-methyl-2-(methylideneamino)penta-1,3-dienyl]methanimine |
| SMILES | C=N/C=C(N=C)/C(C)=C/C.CC |
| InChI | InChI=1S/C8H12N2.C2H6/c1-5-7(2)8(10-4)6-9-3;1-2/h5-6H,3-4H2,1-2H3;1-2H3/b7-5+,8-6-; |
| InChIKey | HUJTYEUCPXUWKT-LFNVCNNASA-N |
| XLogP | 3.22 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|