About 5-hydroxyhept-1-en-2-yl trifluoromethanesulfonate
5-hydroxyhept-1-en-2-yl trifluoromethanesulfonate (PubChem CID 143150621) has the molecular formula C8H13F3O4S
and a molecular weight of 262.25 g/mol. Its IUPAC name is 5-hydroxyhept-1-en-2-yl trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 5-hydroxyhept-1-en-2-yl trifluoromethanesulfonate |
| PubChem CID | 143150621 |
| Molecular Formula | C8H13F3O4S |
| Molecular Weight | 262.25 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 5-hydroxyhept-1-en-2-yl trifluoromethanesulfonate |
| SMILES | C=C(CCC(O)CC)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C8H13F3O4S/c1-3-7(12)5-4-6(2)15-16(13,14)8(9,10)11/h7,12H,2-5H2,1H3 |
| InChIKey | YTKXOZGNZTZMNK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.25 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxyhept-1-en-2-yl trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxyhept-1-en-2-yl trifluoromethanesulfonate?
The IUPAC name of 5-hydroxyhept-1-en-2-yl trifluoromethanesulfonate (CID 143150621) is 5-hydroxyhept-1-en-2-yl trifluoromethanesulfonate.
What is the SMILES notation for 5-hydroxyhept-1-en-2-yl trifluoromethanesulfonate?
The canonical SMILES for 5-hydroxyhept-1-en-2-yl trifluoromethanesulfonate is C=C(CCC(O)CC)OS(=O)(=O)C(F)(F)F.
What is the InChIKey of 5-hydroxyhept-1-en-2-yl trifluoromethanesulfonate?
The InChIKey is YTKXOZGNZTZMNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F3O4S/c1-3-7(12)5-4-6(2)15-16(13,14)8(9,10)11/h7,12H,2-5H2,1H3.
What are the key properties of 5-hydroxyhept-1-en-2-yl trifluoromethanesulfonate?
5-hydroxyhept-1-en-2-yl trifluoromethanesulfonate has a molecular weight of 262.25 g/mol, XLogP of 1.92, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxyhept-1-en-2-yl trifluoromethanesulfonate is sourced from PubChem (CID 143150621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).