C12H15NS — CID 143151031
2-methyl-6-(1,2,3,6-tetrahydropyridin-4-yl)benzenethiol (PubChem CID 143151031) has the molecular formula C12H15NS and a molecular weight of 205.33 g/mol. Its IUPAC name is 2-methyl-6-(1,2,3,6-tetrahydropyridin-4-yl)benzenethiol.
| Compound Name | 2-methyl-6-(1,2,3,6-tetrahydropyridin-4-yl)benzenethiol |
|---|---|
| PubChem CID | 143151031 |
| Molecular Formula | C12H15NS |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 2-methyl-6-(1,2,3,6-tetrahydropyridin-4-yl)benzenethiol |
| SMILES | Cc1cccc(C2=CCNCC2)c1S |
| InChI | InChI=1S/C12H15NS/c1-9-3-2-4-11(12(9)14)10-5-7-13-8-6-10/h2-5,13-14H,6-8H2,1H3 |
| InChIKey | DFPLDZPQZZVAKY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|