C19H29NO6S — CID 143152571
2-[[4,4-dimethyl-2-[1-[(2-methylpropan-2-yl)oxy]ethyl]-3-oxopentanoyl]amino]benzenesulfonic acid (PubChem CID 143152571) has the molecular formula C19H29NO6S and a molecular weight of 399.51 g/mol. Its IUPAC name is 2-[[4,4-dimethyl-2-[1-[(2-methylpropan-2-yl)oxy]ethyl]-3-oxopentanoyl]amino]benzenesulfonic acid.
| Compound Name | 2-[[4,4-dimethyl-2-[1-[(2-methylpropan-2-yl)oxy]ethyl]-3-oxopentanoyl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 143152571 |
| Molecular Formula | C19H29NO6S |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 2-[[4,4-dimethyl-2-[1-[(2-methylpropan-2-yl)oxy]ethyl]-3-oxopentanoyl]amino]benzenesulfonic acid |
| SMILES | CC(OC(C)(C)C)C(C(=O)Nc1ccccc1S(=O)(=O)O)C(=O)C(C)(C)C |
| InChI | InChI=1S/C19H29NO6S/c1-12(26-19(5,6)7)15(16(21)18(2,3)4)17(22)20-13-10-8-9-11-14(13)27(23,24)25/h8-12,15H,1-7H3,(H,20,22)(H,23,24,25) |
| InChIKey | JHPYBDVZWDECKK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|