C18H25NO8S — CID 58838665
2-[[3-acetyl-6-(2-methoxypropanoyloxy)hexanoyl]amino]benzenesulfonic acid (PubChem CID 58838665) has the molecular formula C18H25NO8S and a molecular weight of 415.46 g/mol. Its IUPAC name is 2-[[3-acetyl-6-(2-methoxypropanoyloxy)hexanoyl]amino]benzenesulfonic acid.
| Compound Name | 2-[[3-acetyl-6-(2-methoxypropanoyloxy)hexanoyl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 58838665 |
| Molecular Formula | C18H25NO8S |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 2-[[3-acetyl-6-(2-methoxypropanoyloxy)hexanoyl]amino]benzenesulfonic acid |
| SMILES | COC(C)C(=O)OCCCC(CC(=O)Nc1ccccc1S(=O)(=O)O)C(C)=O |
| InChI | InChI=1S/C18H25NO8S/c1-12(20)14(7-6-10-27-18(22)13(2)26-3)11-17(21)19-15-8-4-5-9-16(15)28(23,24)25/h4-5,8-9,13-14H,6-7,10-11H2,1-3H3,(H,19,21)(H,23,24,25) |
| InChIKey | CHQMEUCFTONMGB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|