About methane;2-[[3-(2-methoxypropanoyloxy)-7-oxooctanoyl]amino]benzenesulfonic acid;hydrofluoride
methane;2-[[3-(2-methoxypropanoyloxy)-7-oxooctanoyl]amino]benzenesulfonic acid;hydrofluoride (PubChem CID 157141421) has the molecular formula C19H30FNO8S
and a molecular weight of 451.51 g/mol. Its IUPAC name is methane;2-[[3-(2-methoxypropanoyloxy)-7-oxooctanoyl]amino]benzenesulfonic acid;hydrofluoride.
Molecular Properties
| Compound Name | methane;2-[[3-(2-methoxypropanoyloxy)-7-oxooctanoyl]amino]benzenesulfonic acid;hydrofluoride |
| PubChem CID | 157141421 |
| Molecular Formula | C19H30FNO8S |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | methane;2-[[3-(2-methoxypropanoyloxy)-7-oxooctanoyl]amino]benzenesulfonic acid;hydrofluoride |
| SMILES | C.COC(C)C(=O)OC(CCCC(C)=O)CC(=O)Nc1ccccc1S(=O)(=O)O.F |
| InChI | InChI=1S/C18H25NO8S.CH4.FH/c1-12(20)7-6-8-14(27-18(22)13(2)26-3)11-17(21)19-15-9-4-5-10-16(15)28(23,24)25;;/h4-5,9-10,13-14H,6-8,11H2,1-3H3,(H,19,21)(H,23,24,25);1H4;1H |
| InChIKey | AKFRDDVKTIIQFA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze methane;2-[[3-(2-methoxypropanoyloxy)-7-oxooctanoyl]amino]benzenesulfonic acid;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-[[3-(2-methoxypropanoyloxy)-7-oxooctanoyl]amino]benzenesulfonic acid;hydrofluoride?
The IUPAC name of methane;2-[[3-(2-methoxypropanoyloxy)-7-oxooctanoyl]amino]benzenesulfonic acid;hydrofluoride (CID 157141421) is methane;2-[[3-(2-methoxypropanoyloxy)-7-oxooctanoyl]amino]benzenesulfonic acid;hydrofluoride.
What is the SMILES notation for methane;2-[[3-(2-methoxypropanoyloxy)-7-oxooctanoyl]amino]benzenesulfonic acid;hydrofluoride?
The canonical SMILES for methane;2-[[3-(2-methoxypropanoyloxy)-7-oxooctanoyl]amino]benzenesulfonic acid;hydrofluoride is C.COC(C)C(=O)OC(CCCC(C)=O)CC(=O)Nc1ccccc1S(=O)(=O)O.F.
What is the InChIKey of methane;2-[[3-(2-methoxypropanoyloxy)-7-oxooctanoyl]amino]benzenesulfonic acid;hydrofluoride?
The InChIKey is AKFRDDVKTIIQFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25NO8S.CH4.FH/c1-12(20)7-6-8-14(27-18(22)13(2)26-3)11-17(21)19-15-9-4-5-10-16(15)28(23,24)25;;/h4-5,9-10,13-14H,6-8,11H2,1-3H3,(H,19,21)(H,23,24,25);1H4;1H.
What are the key properties of methane;2-[[3-(2-methoxypropanoyloxy)-7-oxooctanoyl]amino]benzenesulfonic acid;hydrofluoride?
methane;2-[[3-(2-methoxypropanoyloxy)-7-oxooctanoyl]amino]benzenesulfonic acid;hydrofluoride has a molecular weight of 451.51 g/mol, XLogP of 2.76, 11 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-[[3-(2-methoxypropanoyloxy)-7-oxooctanoyl]amino]benzenesulfonic acid;hydrofluoride is sourced from PubChem (CID 157141421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).