C37H55NO8S — CID 89185642
phenyl 2-[[9,9-dimethyl-8-oxo-3-[2,3,3-trimethyl-5-[(2-methylpropan-2-yl)oxy]-4-oxohexan-2-yl]oxydecanoyl]amino]benzenesulfonate (PubChem CID 89185642) has the molecular formula C37H55NO8S and a molecular weight of 673.91 g/mol. Its IUPAC name is phenyl 2-[[9,9-dimethyl-8-oxo-3-[2,3,3-trimethyl-5-[(2-methylpropan-2-yl)oxy]-4-oxohexan-2-yl]oxydecanoyl]amino]benzenesulfonate.
| Compound Name | phenyl 2-[[9,9-dimethyl-8-oxo-3-[2,3,3-trimethyl-5-[(2-methylpropan-2-yl)oxy]-4-oxohexan-2-yl]oxydecanoyl]amino]benzenesulfonate |
|---|---|
| PubChem CID | 89185642 |
| Molecular Formula | C37H55NO8S |
| Molecular Weight | 673.91 g/mol |
| Exact Mass | 673.36 |
| IUPAC Name | phenyl 2-[[9,9-dimethyl-8-oxo-3-[2,3,3-trimethyl-5-[(2-methylpropan-2-yl)oxy]-4-oxohexan-2-yl]oxydecanoyl]amino]benzenesulfonate |
| SMILES | CC(OC(C)(C)C)C(=O)C(C)(C)C(C)(C)OC(CCCCC(=O)C(C)(C)C)CC(=O)Nc1ccccc1S(=O)(=O)Oc1ccccc1 |
| InChI | InChI=1S/C37H55NO8S/c1-26(44-35(5,6)7)33(41)36(8,9)37(10,11)45-28(21-15-18-24-31(39)34(2,3)4)25-32(40)38-29-22-16-17-23-30(29)47(42,43)46-27-19-13-12-14-20-27/h12-14,16-17,19-20,22-23,26,28H,15,18,21,24-25H2,1-11H3,(H,38,40) |
| InChIKey | CULJAEAHGVHKOQ-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.91 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|