C20H31NO8S — CID 159295732
[9-(2-methoxysulfonylanilino)-2,9-dioxononan-3-yl] 2-methoxypropanoate;molecular hydrogen (PubChem CID 159295732) has the molecular formula C20H31NO8S and a molecular weight of 445.53 g/mol. Its IUPAC name is [9-(2-methoxysulfonylanilino)-2,9-dioxononan-3-yl] 2-methoxypropanoate;molecular hydrogen.
| Compound Name | [9-(2-methoxysulfonylanilino)-2,9-dioxononan-3-yl] 2-methoxypropanoate;molecular hydrogen |
|---|---|
| PubChem CID | 159295732 |
| Molecular Formula | C20H31NO8S |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | [9-(2-methoxysulfonylanilino)-2,9-dioxononan-3-yl] 2-methoxypropanoate;molecular hydrogen |
| SMILES | COC(C)C(=O)OC(CCCCCC(=O)Nc1ccccc1S(=O)(=O)OC)C(C)=O.[H][H] |
| InChI | InChI=1S/C20H29NO8S.H2/c1-14(22)17(29-20(24)15(2)27-3)11-6-5-7-13-19(23)21-16-10-8-9-12-18(16)30(25,26)28-4;/h8-10,12,15,17H,5-7,11,13H2,1-4H3,(H,21,23);1H |
| InChIKey | LARRSWCZRATKBD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|