About methane;[1-(2-methoxysulfonylanilino)-1,4-dioxopentan-3-yl] 2-methoxy-2-phenylacetate;molecular hydrogen
methane;[1-(2-methoxysulfonylanilino)-1,4-dioxopentan-3-yl] 2-methoxy-2-phenylacetate;molecular hydrogen (PubChem CID 160988818) has the molecular formula C22H29NO8S
and a molecular weight of 467.54 g/mol. Its IUPAC name is methane;[1-(2-methoxysulfonylanilino)-1,4-dioxopentan-3-yl] 2-methoxy-2-phenylacetate;molecular hydrogen.
Molecular Properties
| Compound Name | methane;[1-(2-methoxysulfonylanilino)-1,4-dioxopentan-3-yl] 2-methoxy-2-phenylacetate;molecular hydrogen |
| PubChem CID | 160988818 |
| Molecular Formula | C22H29NO8S |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | methane;[1-(2-methoxysulfonylanilino)-1,4-dioxopentan-3-yl] 2-methoxy-2-phenylacetate;molecular hydrogen |
| SMILES | C.COC(C(=O)OC(CC(=O)Nc1ccccc1S(=O)(=O)OC)C(C)=O)c1ccccc1.[H][H] |
| InChI | InChI=1S/C21H23NO8S.CH4.H2/c1-14(23)17(30-21(25)20(28-2)15-9-5-4-6-10-15)13-19(24)22-16-11-7-8-12-18(16)31(26,27)29-3;;/h4-12,17,20H,13H2,1-3H3,(H,22,24);1H4;1H |
| InChIKey | TUIQOWKQBVSERU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze methane;[1-(2-methoxysulfonylanilino)-1,4-dioxopentan-3-yl] 2-methoxy-2-phenylacetate;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;[1-(2-methoxysulfonylanilino)-1,4-dioxopentan-3-yl] 2-methoxy-2-phenylacetate;molecular hydrogen?
The IUPAC name of methane;[1-(2-methoxysulfonylanilino)-1,4-dioxopentan-3-yl] 2-methoxy-2-phenylacetate;molecular hydrogen (CID 160988818) is methane;[1-(2-methoxysulfonylanilino)-1,4-dioxopentan-3-yl] 2-methoxy-2-phenylacetate;molecular hydrogen.
What is the SMILES notation for methane;[1-(2-methoxysulfonylanilino)-1,4-dioxopentan-3-yl] 2-methoxy-2-phenylacetate;molecular hydrogen?
The canonical SMILES for methane;[1-(2-methoxysulfonylanilino)-1,4-dioxopentan-3-yl] 2-methoxy-2-phenylacetate;molecular hydrogen is C.COC(C(=O)OC(CC(=O)Nc1ccccc1S(=O)(=O)OC)C(C)=O)c1ccccc1.[H][H].
What is the InChIKey of methane;[1-(2-methoxysulfonylanilino)-1,4-dioxopentan-3-yl] 2-methoxy-2-phenylacetate;molecular hydrogen?
The InChIKey is TUIQOWKQBVSERU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23NO8S.CH4.H2/c1-14(23)17(30-21(25)20(28-2)15-9-5-4-6-10-15)13-19(24)22-16-11-7-8-12-18(16)31(26,27)29-3;;/h4-12,17,20H,13H2,1-3H3,(H,22,24);1H4;1H.
What are the key properties of methane;[1-(2-methoxysulfonylanilino)-1,4-dioxopentan-3-yl] 2-methoxy-2-phenylacetate;molecular hydrogen?
methane;[1-(2-methoxysulfonylanilino)-1,4-dioxopentan-3-yl] 2-methoxy-2-phenylacetate;molecular hydrogen has a molecular weight of 467.54 g/mol, XLogP of 3.12, 10 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methane;[1-(2-methoxysulfonylanilino)-1,4-dioxopentan-3-yl] 2-methoxy-2-phenylacetate;molecular hydrogen is sourced from PubChem (CID 160988818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).