C19H27NO8S — CID 58749996
[3-[2-(2-methoxysulfonylanilino)-2-oxoethyl]-5-oxohexyl] 2-methoxypropanoate (PubChem CID 58749996) has the molecular formula C19H27NO8S and a molecular weight of 429.49 g/mol. Its IUPAC name is [3-[2-(2-methoxysulfonylanilino)-2-oxoethyl]-5-oxohexyl] 2-methoxypropanoate.
| Compound Name | [3-[2-(2-methoxysulfonylanilino)-2-oxoethyl]-5-oxohexyl] 2-methoxypropanoate |
|---|---|
| PubChem CID | 58749996 |
| Molecular Formula | C19H27NO8S |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | [3-[2-(2-methoxysulfonylanilino)-2-oxoethyl]-5-oxohexyl] 2-methoxypropanoate |
| SMILES | COC(C)C(=O)OCCC(CC(C)=O)CC(=O)Nc1ccccc1S(=O)(=O)OC |
| InChI | InChI=1S/C19H27NO8S/c1-13(21)11-15(9-10-28-19(23)14(2)26-3)12-18(22)20-16-7-5-6-8-17(16)29(24,25)27-4/h5-8,14-15H,9-12H2,1-4H3,(H,20,22) |
| InChIKey | KKLVWPRNJRTIKK-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|