C19H30FNO8S — CID 159216229
methane;2-[[3-[2-(2-methoxypropanoyloxy)ethyl]-5-oxohexanoyl]amino]benzenesulfonic acid;hydrofluoride (PubChem CID 159216229) has the molecular formula C19H30FNO8S and a molecular weight of 451.51 g/mol. Its IUPAC name is methane;2-[[3-[2-(2-methoxypropanoyloxy)ethyl]-5-oxohexanoyl]amino]benzenesulfonic acid;hydrofluoride.
| Compound Name | methane;2-[[3-[2-(2-methoxypropanoyloxy)ethyl]-5-oxohexanoyl]amino]benzenesulfonic acid;hydrofluoride |
|---|---|
| PubChem CID | 159216229 |
| Molecular Formula | C19H30FNO8S |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | methane;2-[[3-[2-(2-methoxypropanoyloxy)ethyl]-5-oxohexanoyl]amino]benzenesulfonic acid;hydrofluoride |
| SMILES | C.COC(C)C(=O)OCCC(CC(C)=O)CC(=O)Nc1ccccc1S(=O)(=O)O.F |
| InChI | InChI=1S/C18H25NO8S.CH4.FH/c1-12(20)10-14(8-9-27-18(22)13(2)26-3)11-17(21)19-15-6-4-5-7-16(15)28(23,24)25;;/h4-7,13-14H,8-11H2,1-3H3,(H,19,21)(H,23,24,25);1H4;1H |
| InChIKey | KRCJSBDLYXILAF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|