C17H26FNO8S — CID 159437706
methane;2-[[4-(2-methoxypropanoyloxy)-5-oxohexanoyl]amino]benzenesulfonic acid;hydrofluoride (PubChem CID 159437706) has the molecular formula C17H26FNO8S and a molecular weight of 423.46 g/mol. Its IUPAC name is methane;2-[[4-(2-methoxypropanoyloxy)-5-oxohexanoyl]amino]benzenesulfonic acid;hydrofluoride.
| Compound Name | methane;2-[[4-(2-methoxypropanoyloxy)-5-oxohexanoyl]amino]benzenesulfonic acid;hydrofluoride |
|---|---|
| PubChem CID | 159437706 |
| Molecular Formula | C17H26FNO8S |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | methane;2-[[4-(2-methoxypropanoyloxy)-5-oxohexanoyl]amino]benzenesulfonic acid;hydrofluoride |
| SMILES | C.COC(C)C(=O)OC(CCC(=O)Nc1ccccc1S(=O)(=O)O)C(C)=O.F |
| InChI | InChI=1S/C16H21NO8S.CH4.FH/c1-10(18)13(25-16(20)11(2)24-3)8-9-15(19)17-12-6-4-5-7-14(12)26(21,22)23;;/h4-7,11,13H,8-9H2,1-3H3,(H,17,19)(H,21,22,23);1H4;1H |
| InChIKey | LRTZZTJERCDVML-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|