C24H32Cl2N2O4S — CID 143154853
N-[1-[(4E,7Z)-5-chlorocycloocta-1,2,4,7-tetraen-1-yl]ethyl]-2,3-dihydroxy-N-propyl-N'-(2-thiophen-2-ylethyl)butanediamide;chloromethane (PubChem CID 143154853) has the molecular formula C24H32Cl2N2O4S and a molecular weight of 515.50 g/mol. Its IUPAC name is N-[1-[(4E,7Z)-5-chlorocycloocta-1,2,4,7-tetraen-1-yl]ethyl]-2,3-dihydroxy-N-propyl-N'-(2-thiophen-2-ylethyl)butanediamide;chloromethane.
| Compound Name | N-[1-[(4E,7Z)-5-chlorocycloocta-1,2,4,7-tetraen-1-yl]ethyl]-2,3-dihydroxy-N-propyl-N'-(2-thiophen-2-ylethyl)butanediamide;chloromethane |
|---|---|
| PubChem CID | 143154853 |
| Molecular Formula | C24H32Cl2N2O4S |
| Molecular Weight | 515.50 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | N-[1-[(4E,7Z)-5-chlorocycloocta-1,2,4,7-tetraen-1-yl]ethyl]-2,3-dihydroxy-N-propyl-N'-(2-thiophen-2-ylethyl)butanediamide;chloromethane |
| SMILES | CCCN(C(=O)C(O)C(O)C(=O)NCCc1cccs1)C(C)C1=C=C/C=C(/Cl)C/C=C\1.CCl |
| InChI | InChI=1S/C23H29ClN2O4S.CH3Cl/c1-3-14-26(16(2)17-7-4-9-18(24)10-5-8-17)23(30)21(28)20(27)22(29)25-13-12-19-11-6-15-31-19;1-2/h4-7,10-11,15-16,20-21,27-28H,3,9,12-14H2,1-2H3,(H,25,29);1H3/b7-4-,18-10+; |
| InChIKey | LLIHKTUHLXXXHT-RPOYXGNFSA-N |
| XLogP | 3.77 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.50 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|