C24H37BrN2O4S — CID 143154931
acetylene;(E)-2-bromobut-2-ene;2,3-dihydroxy-N-pent-4-en-2-yl-N-propyl-N'-(2-thiophen-2-ylethyl)butanediamide (PubChem CID 143154931) has the molecular formula C24H37BrN2O4S and a molecular weight of 529.54 g/mol. Its IUPAC name is acetylene;(E)-2-bromobut-2-ene;2,3-dihydroxy-N-pent-4-en-2-yl-N-propyl-N'-(2-thiophen-2-ylethyl)butanediamide.
| Compound Name | acetylene;(E)-2-bromobut-2-ene;2,3-dihydroxy-N-pent-4-en-2-yl-N-propyl-N'-(2-thiophen-2-ylethyl)butanediamide |
|---|---|
| PubChem CID | 143154931 |
| Molecular Formula | C24H37BrN2O4S |
| Molecular Weight | 529.54 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | acetylene;(E)-2-bromobut-2-ene;2,3-dihydroxy-N-pent-4-en-2-yl-N-propyl-N'-(2-thiophen-2-ylethyl)butanediamide |
| SMILES | C#C.C/C=C(\C)Br.C=CCC(C)N(CCC)C(=O)C(O)C(O)C(=O)NCCc1cccs1 |
| InChI | InChI=1S/C18H28N2O4S.C4H7Br.C2H2/c1-4-7-13(3)20(11-5-2)18(24)16(22)15(21)17(23)19-10-9-14-8-6-12-25-14;1-3-4(2)5;1-2/h4,6,8,12-13,15-16,21-22H,1,5,7,9-11H2,2-3H3,(H,19,23);3H,1-2H3;1-2H/b;4-3+; |
| InChIKey | QSIIGCDOBWKMJT-ITDJAWRYSA-N |
| XLogP | 3.89 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.54 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|