C23H37N3O4S — CID 143154745
N-[(4Z,6E)-6-(ethylamino)octa-4,6-dien-2-yl]-2,3-dihydroxy-N-propyl-N'-(2-thiophen-2-ylethyl)butanediamide (PubChem CID 143154745) has the molecular formula C23H37N3O4S and a molecular weight of 451.63 g/mol. Its IUPAC name is N-[(4Z,6E)-6-(ethylamino)octa-4,6-dien-2-yl]-2,3-dihydroxy-N-propyl-N'-(2-thiophen-2-ylethyl)butanediamide.
| Compound Name | N-[(4Z,6E)-6-(ethylamino)octa-4,6-dien-2-yl]-2,3-dihydroxy-N-propyl-N'-(2-thiophen-2-ylethyl)butanediamide |
|---|---|
| PubChem CID | 143154745 |
| Molecular Formula | C23H37N3O4S |
| Molecular Weight | 451.63 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | N-[(4Z,6E)-6-(ethylamino)octa-4,6-dien-2-yl]-2,3-dihydroxy-N-propyl-N'-(2-thiophen-2-ylethyl)butanediamide |
| SMILES | C/C=C(\C=C/CC(C)N(CCC)C(=O)C(O)C(O)C(=O)NCCc1cccs1)NCC |
| InChI | InChI=1S/C23H37N3O4S/c1-5-15-26(17(4)10-8-11-18(6-2)24-7-3)23(30)21(28)20(27)22(29)25-14-13-19-12-9-16-31-19/h6,8-9,11-12,16-17,20-21,24,27-28H,5,7,10,13-15H2,1-4H3,(H,25,29)/b11-8-,18-6+ |
| InChIKey | JYBVPVJOFZLMAW-PQWBMGSUSA-N |
| XLogP | 2.22 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.63 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|