C18H18F3NO2S2 — CID 143156133
acetaldehyde;2-methylsulfanyl-1-[4-[[4-(trifluoromethyl)phenyl]sulfanylamino]phenyl]ethanone (PubChem CID 143156133) has the molecular formula C18H18F3NO2S2 and a molecular weight of 401.48 g/mol. Its IUPAC name is acetaldehyde;2-methylsulfanyl-1-[4-[[4-(trifluoromethyl)phenyl]sulfanylamino]phenyl]ethanone.
| Compound Name | acetaldehyde;2-methylsulfanyl-1-[4-[[4-(trifluoromethyl)phenyl]sulfanylamino]phenyl]ethanone |
|---|---|
| PubChem CID | 143156133 |
| Molecular Formula | C18H18F3NO2S2 |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | acetaldehyde;2-methylsulfanyl-1-[4-[[4-(trifluoromethyl)phenyl]sulfanylamino]phenyl]ethanone |
| SMILES | CC=O.CSCC(=O)c1ccc(NSc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C16H14F3NOS2.C2H4O/c1-22-10-15(21)11-2-6-13(7-3-11)20-23-14-8-4-12(5-9-14)16(17,18)19;1-2-3/h2-9,20H,10H2,1H3;2H,1H3 |
| InChIKey | JYRHMEBTUDFMMW-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|