C18H15F3N4OS2 — CID 145483705
4-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]sulfanyl-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide (PubChem CID 145483705) has the molecular formula C18H15F3N4OS2 and a molecular weight of 424.47 g/mol. Its IUPAC name is 4-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]sulfanyl-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide.
| Compound Name | 4-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]sulfanyl-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 145483705 |
| Molecular Formula | C18H15F3N4OS2 |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | 4-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]sulfanyl-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide |
| SMILES | Cc1nsc(NSc2ccc(C(=O)NCc3ccc(C(F)(F)F)cc3)cc2)n1 |
| InChI | InChI=1S/C18H15F3N4OS2/c1-11-23-17(28-24-11)25-27-15-8-4-13(5-9-15)16(26)22-10-12-2-6-14(7-3-12)18(19,20)21/h2-9H,10H2,1H3,(H,22,26)(H,23,24,25) |
| InChIKey | JBJCKATVXHMTBU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|