C17H13F3N4OS2 — CID 145483681
3-(1,3,4-thiadiazol-2-ylamino)sulfanyl-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide (PubChem CID 145483681) has the molecular formula C17H13F3N4OS2 and a molecular weight of 410.45 g/mol. Its IUPAC name is 3-(1,3,4-thiadiazol-2-ylamino)sulfanyl-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide.
| Compound Name | 3-(1,3,4-thiadiazol-2-ylamino)sulfanyl-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 145483681 |
| Molecular Formula | C17H13F3N4OS2 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | 3-(1,3,4-thiadiazol-2-ylamino)sulfanyl-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(C(F)(F)F)cc1)c1cccc(SNc2nncs2)c1 |
| InChI | InChI=1S/C17H13F3N4OS2/c18-17(19,20)13-6-4-11(5-7-13)9-21-15(25)12-2-1-3-14(8-12)27-24-16-23-22-10-26-16/h1-8,10H,9H2,(H,21,25)(H,23,24) |
| InChIKey | XTYFCBFRARMNRT-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|