C22H25ClN4OS — CID 143161831
3-[1-(3-chloropropylsulfanyl)piperidin-4-yl]-5-phenyl-2H-indazole-7-carboxamide (PubChem CID 143161831) has the molecular formula C22H25ClN4OS and a molecular weight of 428.99 g/mol. Its IUPAC name is 3-[1-(3-chloropropylsulfanyl)piperidin-4-yl]-5-phenyl-2H-indazole-7-carboxamide.
| Compound Name | 3-[1-(3-chloropropylsulfanyl)piperidin-4-yl]-5-phenyl-2H-indazole-7-carboxamide |
|---|---|
| PubChem CID | 143161831 |
| Molecular Formula | C22H25ClN4OS |
| Molecular Weight | 428.99 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 3-[1-(3-chloropropylsulfanyl)piperidin-4-yl]-5-phenyl-2H-indazole-7-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccccc2)cc2c(C3CCN(SCCCCl)CC3)[nH]nc12 |
| InChI | InChI=1S/C22H25ClN4OS/c23-9-4-12-29-27-10-7-16(8-11-27)20-18-13-17(15-5-2-1-3-6-15)14-19(22(24)28)21(18)26-25-20/h1-3,5-6,13-14,16H,4,7-12H2,(H2,24,28)(H,25,26) |
| InChIKey | DFPYNRRGAOBLPZ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.99 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|