C25H30N6O2S — CID 143161852
3-[1-[1-[(C,N-dimethylcarbonimidoyl)amino]ethenylsulfanyl]piperidin-4-yl]-5-[4-(hydroxymethyl)phenyl]-2H-indazole-7-carboxamide (PubChem CID 143161852) has the molecular formula C25H30N6O2S and a molecular weight of 478.62 g/mol. Its IUPAC name is 3-[1-[1-[(C,N-dimethylcarbonimidoyl)amino]ethenylsulfanyl]piperidin-4-yl]-5-[4-(hydroxymethyl)phenyl]-2H-indazole-7-carboxamide.
| Compound Name | 3-[1-[1-[(C,N-dimethylcarbonimidoyl)amino]ethenylsulfanyl]piperidin-4-yl]-5-[4-(hydroxymethyl)phenyl]-2H-indazole-7-carboxamide |
|---|---|
| PubChem CID | 143161852 |
| Molecular Formula | C25H30N6O2S |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | 3-[1-[1-[(C,N-dimethylcarbonimidoyl)amino]ethenylsulfanyl]piperidin-4-yl]-5-[4-(hydroxymethyl)phenyl]-2H-indazole-7-carboxamide |
| SMILES | C=C(N/C(C)=N/C)SN1CCC(c2[nH]nc3c(C(N)=O)cc(-c4ccc(CO)cc4)cc23)CC1 |
| InChI | InChI=1S/C25H30N6O2S/c1-15(27-3)28-16(2)34-31-10-8-19(9-11-31)23-21-12-20(18-6-4-17(14-32)5-7-18)13-22(25(26)33)24(21)30-29-23/h4-7,12-13,19,32H,2,8-11,14H2,1,3H3,(H2,26,33)(H,27,28)(H,29,30) |
| InChIKey | OSLJIASYJBPCMQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 119.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|