C15H24F3N — CID 143162418
4-methyl-1-[(3E,5Z)-8,8,8-trifluoro-7-methylocta-3,5-dien-4-yl]piperidine (PubChem CID 143162418) has the molecular formula C15H24F3N and a molecular weight of 275.36 g/mol. Its IUPAC name is 4-methyl-1-[(3E,5Z)-8,8,8-trifluoro-7-methylocta-3,5-dien-4-yl]piperidine.
| Compound Name | 4-methyl-1-[(3E,5Z)-8,8,8-trifluoro-7-methylocta-3,5-dien-4-yl]piperidine |
|---|---|
| PubChem CID | 143162418 |
| Molecular Formula | C15H24F3N |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 4-methyl-1-[(3E,5Z)-8,8,8-trifluoro-7-methylocta-3,5-dien-4-yl]piperidine |
| SMILES | CC/C=C(\C=C/C(C)C(F)(F)F)N1CCC(C)CC1 |
| InChI | InChI=1S/C15H24F3N/c1-4-5-14(7-6-13(3)15(16,17)18)19-10-8-12(2)9-11-19/h5-7,12-13H,4,8-11H2,1-3H3/b7-6-,14-5+ |
| InChIKey | YOGJVAWIWRLUIS-WFRORPSUSA-N |
| XLogP | 4.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|