C29H35NO9 — CID 143165378
diethyl 2-[benzyl-(2-methyl-4,6-dioxo-6-phenylmethoxyhexan-2-yl)oxycarbonylamino]propanedioate (PubChem CID 143165378) has the molecular formula C29H35NO9 and a molecular weight of 541.60 g/mol. Its IUPAC name is diethyl 2-[benzyl-(2-methyl-4,6-dioxo-6-phenylmethoxyhexan-2-yl)oxycarbonylamino]propanedioate.
| Compound Name | diethyl 2-[benzyl-(2-methyl-4,6-dioxo-6-phenylmethoxyhexan-2-yl)oxycarbonylamino]propanedioate |
|---|---|
| PubChem CID | 143165378 |
| Molecular Formula | C29H35NO9 |
| Molecular Weight | 541.60 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | diethyl 2-[benzyl-(2-methyl-4,6-dioxo-6-phenylmethoxyhexan-2-yl)oxycarbonylamino]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)N(Cc1ccccc1)C(=O)OC(C)(C)CC(=O)CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H35NO9/c1-5-36-26(33)25(27(34)37-6-2)30(19-21-13-9-7-10-14-21)28(35)39-29(3,4)18-23(31)17-24(32)38-20-22-15-11-8-12-16-22/h7-16,25H,5-6,17-20H2,1-4H3 |
| InChIKey | WYMLZEFOYIHIHO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 125.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.60 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|