C22H22F3N3 — CID 143165849
4-aminobenzenecarboximidamide;1-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]benzene (PubChem CID 143165849) has the molecular formula C22H22F3N3 and a molecular weight of 385.43 g/mol. Its IUPAC name is 4-aminobenzenecarboximidamide;1-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]benzene.
| Compound Name | 4-aminobenzenecarboximidamide;1-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]benzene |
|---|---|
| PubChem CID | 143165849 |
| Molecular Formula | C22H22F3N3 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 4-aminobenzenecarboximidamide;1-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]benzene |
| SMILES | Cc1cccc(Cc2cccc(C(F)(F)F)c2)c1.[H]/N=C(\N)c1ccc(N)cc1 |
| InChI | InChI=1S/C15H13F3.C7H9N3/c1-11-4-2-5-12(8-11)9-13-6-3-7-14(10-13)15(16,17)18;8-6-3-1-5(2-4-6)7(9)10/h2-8,10H,9H2,1H3;1-4H,8H2,(H3,9,10) |
| InChIKey | ATHBMUDNBPTONI-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|