C19H19ClO — CID 143166017
5-(3-chloro-4-ethynylphenyl)-5-phenylpentan-1-ol (PubChem CID 143166017) has the molecular formula C19H19ClO and a molecular weight of 298.81 g/mol. Its IUPAC name is 5-(3-chloro-4-ethynylphenyl)-5-phenylpentan-1-ol.
| Compound Name | 5-(3-chloro-4-ethynylphenyl)-5-phenylpentan-1-ol |
|---|---|
| PubChem CID | 143166017 |
| Molecular Formula | C19H19ClO |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 5-(3-chloro-4-ethynylphenyl)-5-phenylpentan-1-ol |
| SMILES | C#Cc1ccc(C(CCCCO)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C19H19ClO/c1-2-15-11-12-17(14-19(15)20)18(10-6-7-13-21)16-8-4-3-5-9-16/h1,3-5,8-9,11-12,14,18,21H,6-7,10,13H2 |
| InChIKey | ZVIZBTWVEAFQJA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|