C18H23AsO — CID 173070567
3-(3,3-diphenylpropylarsanyl)propan-1-ol (PubChem CID 173070567) has the molecular formula C18H23AsO and a molecular weight of 330.30 g/mol. Its IUPAC name is 3-(3,3-diphenylpropylarsanyl)propan-1-ol.
| Compound Name | 3-(3,3-diphenylpropylarsanyl)propan-1-ol |
|---|---|
| PubChem CID | 173070567 |
| Molecular Formula | C18H23AsO |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 3-(3,3-diphenylpropylarsanyl)propan-1-ol |
| SMILES | OCCC[AsH]CCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H23AsO/c20-15-7-13-19-14-12-18(16-8-3-1-4-9-16)17-10-5-2-6-11-17/h1-6,8-11,18-20H,7,12-15H2 |
| InChIKey | HSCUVBIMPJDMMK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|