C32H44N8S — CID 143167765
N-[4-[(4-benzylpiperazin-1-yl)methyl]-2-pyridinyl]-5-[2-(hexylamino)pyrimidin-4-yl]-1,3-thiazol-2-amine;ethane (PubChem CID 143167765) has the molecular formula C32H44N8S and a molecular weight of 572.83 g/mol. Its IUPAC name is N-[4-[(4-benzylpiperazin-1-yl)methyl]-2-pyridinyl]-5-[2-(hexylamino)pyrimidin-4-yl]-1,3-thiazol-2-amine;ethane.
| Compound Name | N-[4-[(4-benzylpiperazin-1-yl)methyl]-2-pyridinyl]-5-[2-(hexylamino)pyrimidin-4-yl]-1,3-thiazol-2-amine;ethane |
|---|---|
| PubChem CID | 143167765 |
| Molecular Formula | C32H44N8S |
| Molecular Weight | 572.83 g/mol |
| Exact Mass | 572.34 |
| IUPAC Name | N-[4-[(4-benzylpiperazin-1-yl)methyl]-2-pyridinyl]-5-[2-(hexylamino)pyrimidin-4-yl]-1,3-thiazol-2-amine;ethane |
| SMILES | CC.CCCCCCNc1nccc(-c2cnc(Nc3cc(CN4CCN(Cc5ccccc5)CC4)ccn3)s2)n1 |
| InChI | InChI=1S/C30H38N8S.C2H6/c1-2-3-4-8-13-32-29-33-15-12-26(35-29)27-21-34-30(39-27)36-28-20-25(11-14-31-28)23-38-18-16-37(17-19-38)22-24-9-6-5-7-10-24;1-2/h5-7,9-12,14-15,20-21H,2-4,8,13,16-19,22-23H2,1H3,(H,31,34,36)(H,32,33,35);1-2H3 |
| InChIKey | KHPULTNXLFUQHJ-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 82.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.83 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|