C31H46F3N3O4 — CID 143169307
ethane;6-[4-[2-(2-methoxyethoxy)ethoxy]-2,3-dimethylphenyl]-2-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine;6-(trifluoromethyl)pyridine-3-carbaldehyde (PubChem CID 143169307) has the molecular formula C31H46F3N3O4 and a molecular weight of 581.72 g/mol. Its IUPAC name is ethane;6-[4-[2-(2-methoxyethoxy)ethoxy]-2,3-dimethylphenyl]-2-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine;6-(trifluoromethyl)pyridine-3-carbaldehyde.
| Compound Name | ethane;6-[4-[2-(2-methoxyethoxy)ethoxy]-2,3-dimethylphenyl]-2-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine;6-(trifluoromethyl)pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 143169307 |
| Molecular Formula | C31H46F3N3O4 |
| Molecular Weight | 581.72 g/mol |
| Exact Mass | 581.34 |
| IUPAC Name | ethane;6-[4-[2-(2-methoxyethoxy)ethoxy]-2,3-dimethylphenyl]-2-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine;6-(trifluoromethyl)pyridine-3-carbaldehyde |
| SMILES | CC.COCCOCCOc1ccc(C2CCCC3CN(C)CCN32)c(C)c1C.O=Cc1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C22H36N2O3.C7H4F3NO.C2H6/c1-17-18(2)22(27-15-14-26-13-12-25-4)9-8-20(17)21-7-5-6-19-16-23(3)10-11-24(19)21;8-7(9,10)6-2-1-5(4-12)3-11-6;1-2/h8-9,19,21H,5-7,10-16H2,1-4H3;1-4H;1-2H3 |
| InChIKey | RRNAKURGVGSLDG-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.72 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|