C24H22FN3O4S2 — CID 143171705
methanethioamide;methyl 7-[4-[[(3Z)-3-ethenylhexa-3,5-dienoyl]amino]-2-fluorophenoxy]thieno[3,2-b]pyridine-2-carboxylate (PubChem CID 143171705) has the molecular formula C24H22FN3O4S2 and a molecular weight of 499.59 g/mol. Its IUPAC name is methanethioamide;methyl 7-[4-[[(3Z)-3-ethenylhexa-3,5-dienoyl]amino]-2-fluorophenoxy]thieno[3,2-b]pyridine-2-carboxylate.
| Compound Name | methanethioamide;methyl 7-[4-[[(3Z)-3-ethenylhexa-3,5-dienoyl]amino]-2-fluorophenoxy]thieno[3,2-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 143171705 |
| Molecular Formula | C24H22FN3O4S2 |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | methanethioamide;methyl 7-[4-[[(3Z)-3-ethenylhexa-3,5-dienoyl]amino]-2-fluorophenoxy]thieno[3,2-b]pyridine-2-carboxylate |
| SMILES | C=C/C=C(\C=C)CC(=O)Nc1ccc(Oc2ccnc3cc(C(=O)OC)sc23)c(F)c1.NC=S |
| InChI | InChI=1S/C23H19FN2O4S.CH3NS/c1-4-6-14(5-2)11-21(27)26-15-7-8-18(16(24)12-15)30-19-9-10-25-17-13-20(23(28)29-3)31-22(17)19;2-1-3/h4-10,12-13H,1-2,11H2,3H3,(H,26,27);1H,(H2,2,3)/b14-6+; |
| InChIKey | ZRRQAKBQRXOXKR-JSSTZBRYSA-N |
| XLogP | 5.54 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|