C23H26O4S — CID 143173300
methyl 3-[3-[(E)-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]phenyl]sulfanyl-2-phenylpropanoate (PubChem CID 143173300) has the molecular formula C23H26O4S and a molecular weight of 398.52 g/mol. Its IUPAC name is methyl 3-[3-[(E)-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]phenyl]sulfanyl-2-phenylpropanoate.
| Compound Name | methyl 3-[3-[(E)-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]phenyl]sulfanyl-2-phenylpropanoate |
|---|---|
| PubChem CID | 143173300 |
| Molecular Formula | C23H26O4S |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | methyl 3-[3-[(E)-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]phenyl]sulfanyl-2-phenylpropanoate |
| SMILES | COC(=O)C(CSc1cccc(/C=C/C(=O)OC(C)(C)C)c1)c1ccccc1 |
| InChI | InChI=1S/C23H26O4S/c1-23(2,3)27-21(24)14-13-17-9-8-12-19(15-17)28-16-20(22(25)26-4)18-10-6-5-7-11-18/h5-15,20H,16H2,1-4H3/b14-13+ |
| InChIKey | CHSZWUKQJHAMIH-BUHFOSPRSA-N |
| XLogP | 5.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|