C20H34N2O3S — CID 143174092
N-cycloheptylformamide;1-(3-methylphenyl)sulfonylpiperidine;molecular hydrogen (PubChem CID 143174092) has the molecular formula C20H34N2O3S and a molecular weight of 382.57 g/mol. Its IUPAC name is N-cycloheptylformamide;1-(3-methylphenyl)sulfonylpiperidine;molecular hydrogen.
| Compound Name | N-cycloheptylformamide;1-(3-methylphenyl)sulfonylpiperidine;molecular hydrogen |
|---|---|
| PubChem CID | 143174092 |
| Molecular Formula | C20H34N2O3S |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | N-cycloheptylformamide;1-(3-methylphenyl)sulfonylpiperidine;molecular hydrogen |
| SMILES | Cc1cccc(S(=O)(=O)N2CCCCC2)c1.O=CNC1CCCCCC1.[H][H] |
| InChI | InChI=1S/C12H17NO2S.C8H15NO.H2/c1-11-6-5-7-12(10-11)16(14,15)13-8-3-2-4-9-13;10-7-9-8-5-3-1-2-4-6-8;/h5-7,10H,2-4,8-9H2,1H3;7-8H,1-6H2,(H,9,10);1H |
| InChIKey | PSPPZWLGBITOSB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|