C13H17N5O8S2 — CID 143175592
2-hydroxyethyl 4-[(3,4-dimethoxy-5-oxo-1,2,4-triazole-1-carbonyl)sulfamoyl]-5-methylthiophene-3-carboximidate (PubChem CID 143175592) has the molecular formula C13H17N5O8S2 and a molecular weight of 435.44 g/mol. Its IUPAC name is 2-hydroxyethyl 4-[(3,4-dimethoxy-5-oxo-1,2,4-triazole-1-carbonyl)sulfamoyl]-5-methylthiophene-3-carboximidate.
| Compound Name | 2-hydroxyethyl 4-[(3,4-dimethoxy-5-oxo-1,2,4-triazole-1-carbonyl)sulfamoyl]-5-methylthiophene-3-carboximidate |
|---|---|
| PubChem CID | 143175592 |
| Molecular Formula | C13H17N5O8S2 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.05 |
| IUPAC Name | 2-hydroxyethyl 4-[(3,4-dimethoxy-5-oxo-1,2,4-triazole-1-carbonyl)sulfamoyl]-5-methylthiophene-3-carboximidate |
| SMILES | [H]/N=C(\OCCO)c1csc(C)c1S(=O)(=O)NC(=O)n1nc(OC)n(OC)c1=O |
| InChI | InChI=1S/C13H17N5O8S2/c1-7-9(8(6-27-7)10(14)26-5-4-19)28(22,23)16-11(20)17-13(21)18(25-3)12(15-17)24-2/h6,14,19H,4-5H2,1-3H3,(H,16,20)/b14-10- |
| InChIKey | QGQDWHULJAEDBX-UVTDQMKNSA-N |
| XLogP | -1.24 |
| TPSA | 174.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|