C10H16N2 — CID 143177449
3-cyclohexa-1,3-dien-1-ylpyrrolidin-1-amine (PubChem CID 143177449) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 3-cyclohexa-1,3-dien-1-ylpyrrolidin-1-amine.
| Compound Name | 3-cyclohexa-1,3-dien-1-ylpyrrolidin-1-amine |
|---|---|
| PubChem CID | 143177449 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 3-cyclohexa-1,3-dien-1-ylpyrrolidin-1-amine |
| SMILES | NN1CCC(C2=CC=CCC2)C1 |
| InChI | InChI=1S/C10H16N2/c11-12-7-6-10(8-12)9-4-2-1-3-5-9/h1-2,4,10H,3,5-8,11H2 |
| InChIKey | RPCIYMNYWQRDDP-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|