C15H24N2 — CID 178161582
2-methyl-3-[(1Z)-2-methylbuta-1,3-dienyl]-8-azaspiro[4.5]dec-2-en-8-amine (PubChem CID 178161582) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 2-methyl-3-[(1Z)-2-methylbuta-1,3-dienyl]-8-azaspiro[4.5]dec-2-en-8-amine.
| Compound Name | 2-methyl-3-[(1Z)-2-methylbuta-1,3-dienyl]-8-azaspiro[4.5]dec-2-en-8-amine |
|---|---|
| PubChem CID | 178161582 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 2-methyl-3-[(1Z)-2-methylbuta-1,3-dienyl]-8-azaspiro[4.5]dec-2-en-8-amine |
| SMILES | C=C/C(C)=C\C1=C(C)CC2(CCN(N)CC2)C1 |
| InChI | InChI=1S/C15H24N2/c1-4-12(2)9-14-11-15(10-13(14)3)5-7-17(16)8-6-15/h4,9H,1,5-8,10-11,16H2,2-3H3/b12-9- |
| InChIKey | LXJCCSPVOLNQOX-XFXZXTDPSA-N |
| XLogP | 3.18 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|