C14H21N — CID 142848976
3,4-bis(ethenyl)-8-methyl-8-azaspiro[4.5]dec-3-ene (PubChem CID 142848976) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 3,4-bis(ethenyl)-8-methyl-8-azaspiro[4.5]dec-3-ene.
| Compound Name | 3,4-bis(ethenyl)-8-methyl-8-azaspiro[4.5]dec-3-ene |
|---|---|
| PubChem CID | 142848976 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 3,4-bis(ethenyl)-8-methyl-8-azaspiro[4.5]dec-3-ene |
| SMILES | C=CC1=C(C=C)C2(CC1)CCN(C)CC2 |
| InChI | InChI=1S/C14H21N/c1-4-12-6-7-14(13(12)5-2)8-10-15(3)11-9-14/h4-5H,1-2,6-11H2,3H3 |
| InChIKey | FNBIPLHVBQNXGN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |