C12H20FN — CID 177162805
10-fluoro-3,4,8-trimethyl-8-azaspiro[4.5]dec-3-ene (PubChem CID 177162805) has the molecular formula C12H20FN and a molecular weight of 197.30 g/mol. Its IUPAC name is 10-fluoro-3,4,8-trimethyl-8-azaspiro[4.5]dec-3-ene.
| Compound Name | 10-fluoro-3,4,8-trimethyl-8-azaspiro[4.5]dec-3-ene |
|---|---|
| PubChem CID | 177162805 |
| Molecular Formula | C12H20FN |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.16 |
| IUPAC Name | 10-fluoro-3,4,8-trimethyl-8-azaspiro[4.5]dec-3-ene |
| SMILES | CC1=C(C)C2(CC1)CCN(C)CC2F |
| InChI | InChI=1S/C12H20FN/c1-9-4-5-12(10(9)2)6-7-14(3)8-11(12)13/h11H,4-8H2,1-3H3 |
| InChIKey | ZBZWPWLJYSRQCP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|