C18H32FN — CID 176830002
10-fluoro-3,4,8-tri(propan-2-yl)-8-azaspiro[4.5]dec-3-ene (PubChem CID 176830002) has the molecular formula C18H32FN and a molecular weight of 281.46 g/mol. Its IUPAC name is 10-fluoro-3,4,8-tri(propan-2-yl)-8-azaspiro[4.5]dec-3-ene.
| Compound Name | 10-fluoro-3,4,8-tri(propan-2-yl)-8-azaspiro[4.5]dec-3-ene |
|---|---|
| PubChem CID | 176830002 |
| Molecular Formula | C18H32FN |
| Molecular Weight | 281.46 g/mol |
| Exact Mass | 281.25 |
| IUPAC Name | 10-fluoro-3,4,8-tri(propan-2-yl)-8-azaspiro[4.5]dec-3-ene |
| SMILES | CC(C)C1=C(C(C)C)C2(CC1)CCN(C(C)C)CC2F |
| InChI | InChI=1S/C18H32FN/c1-12(2)15-7-8-18(17(15)13(3)4)9-10-20(14(5)6)11-16(18)19/h12-14,16H,7-11H2,1-6H3 |
| InChIKey | LBHZUKYAGSWIOI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.46 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|