C13H20FN — CID 177162508
(3'R,4S)-3'-fluoro-1',2,3-trimethylspiro[bicyclo[3.1.0]hex-2-ene-4,4'-piperidine] (PubChem CID 177162508) has the molecular formula C13H20FN and a molecular weight of 209.31 g/mol. Its IUPAC name is (3'R,4S)-3'-fluoro-1',2,3-trimethylspiro[bicyclo[3.1.0]hex-2-ene-4,4'-piperidine].
| Compound Name | (3'R,4S)-3'-fluoro-1',2,3-trimethylspiro[bicyclo[3.1.0]hex-2-ene-4,4'-piperidine] |
|---|---|
| PubChem CID | 177162508 |
| Molecular Formula | C13H20FN |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | (3'R,4S)-3'-fluoro-1',2,3-trimethylspiro[bicyclo[3.1.0]hex-2-ene-4,4'-piperidine] |
| SMILES | CC1=C(C)[C@]2(CCN(C)C[C@@H]2F)C2CC12 |
| InChI | InChI=1S/C13H20FN/c1-8-9(2)13(11-6-10(8)11)4-5-15(3)7-12(13)14/h10-12H,4-7H2,1-3H3/t10?,11?,12-,13+/m0/s1 |
| InChIKey | SBWAUPZGOPDTCE-IFWUJCSASA-N |
| XLogP | 2.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|