C15H23N — CID 123471157
3-buta-1,3-dienyl-4,8-dimethyl-8-azaspiro[4.5]dec-3-ene (PubChem CID 123471157) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is 3-buta-1,3-dienyl-4,8-dimethyl-8-azaspiro[4.5]dec-3-ene.
| Compound Name | 3-buta-1,3-dienyl-4,8-dimethyl-8-azaspiro[4.5]dec-3-ene |
|---|---|
| PubChem CID | 123471157 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 3-buta-1,3-dienyl-4,8-dimethyl-8-azaspiro[4.5]dec-3-ene |
| SMILES | C=CC=CC1=C(C)C2(CC1)CCN(C)CC2 |
| InChI | InChI=1S/C15H23N/c1-4-5-6-14-7-8-15(13(14)2)9-11-16(3)12-10-15/h4-6H,1,7-12H2,2-3H3 |
| InChIKey | XOHBHXUADVMTIF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|