C16H27N — CID 143782115
4-ethenyl-3,8-dimethyl-8-azaspiro[4.5]dec-3-ene;prop-1-ene (PubChem CID 143782115) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is 4-ethenyl-3,8-dimethyl-8-azaspiro[4.5]dec-3-ene;prop-1-ene.
| Compound Name | 4-ethenyl-3,8-dimethyl-8-azaspiro[4.5]dec-3-ene;prop-1-ene |
|---|---|
| PubChem CID | 143782115 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | 4-ethenyl-3,8-dimethyl-8-azaspiro[4.5]dec-3-ene;prop-1-ene |
| SMILES | C=CC.C=CC1=C(C)CCC12CCN(C)CC2 |
| InChI | InChI=1S/C13H21N.C3H6/c1-4-12-11(2)5-6-13(12)7-9-14(3)10-8-13;1-3-2/h4H,1,5-10H2,2-3H3;3H,1H2,2H3 |
| InChIKey | KTPSBYNQRDPIFI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|