C15H23N — CID 143782142
4-ethenyl-8-methyl-3-[(Z)-prop-1-enyl]-8-azaspiro[4.5]dec-3-ene (PubChem CID 143782142) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is 4-ethenyl-8-methyl-3-[(Z)-prop-1-enyl]-8-azaspiro[4.5]dec-3-ene.
| Compound Name | 4-ethenyl-8-methyl-3-[(Z)-prop-1-enyl]-8-azaspiro[4.5]dec-3-ene |
|---|---|
| PubChem CID | 143782142 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 4-ethenyl-8-methyl-3-[(Z)-prop-1-enyl]-8-azaspiro[4.5]dec-3-ene |
| SMILES | C=CC1=C(/C=C\C)CCC12CCN(C)CC2 |
| InChI | InChI=1S/C15H23N/c1-4-6-13-7-8-15(14(13)5-2)9-11-16(3)12-10-15/h4-6H,2,7-12H2,1,3H3/b6-4- |
| InChIKey | LAPBNXYWCVWBMW-XQRVVYSFSA-N |
| XLogP | 3.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |