C14H26N2OS — CID 143180810
(2E,4Z)-6-methyl-N-[5-(methylamino)pentyl]hepta-2,4,6-triene-3-sulfinamide (PubChem CID 143180810) has the molecular formula C14H26N2OS and a molecular weight of 270.44 g/mol. Its IUPAC name is (2E,4Z)-6-methyl-N-[5-(methylamino)pentyl]hepta-2,4,6-triene-3-sulfinamide.
| Compound Name | (2E,4Z)-6-methyl-N-[5-(methylamino)pentyl]hepta-2,4,6-triene-3-sulfinamide |
|---|---|
| PubChem CID | 143180810 |
| Molecular Formula | C14H26N2OS |
| Molecular Weight | 270.44 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | (2E,4Z)-6-methyl-N-[5-(methylamino)pentyl]hepta-2,4,6-triene-3-sulfinamide |
| SMILES | C=C(C)/C=C\C(=C/C)S(=O)NCCCCCNC |
| InChI | InChI=1S/C14H26N2OS/c1-5-14(10-9-13(2)3)18(17)16-12-8-6-7-11-15-4/h5,9-10,15-16H,2,6-8,11-12H2,1,3-4H3/b10-9-,14-5+ |
| InChIKey | YBFOJPFBFZUDNR-DVBADTPPSA-N |
| XLogP | 2.67 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|